C19H21ClO2 — CID 118457980
(3S)-3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane (PubChem CID 118457980) has the molecular formula C19H21ClO2 and a molecular weight of 316.83 g/mol. Its IUPAC name is (3S)-3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane.
| Compound Name | (3S)-3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane |
|---|---|
| PubChem CID | 118457980 |
| Molecular Formula | C19H21ClO2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (3S)-3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane |
| SMILES | CCc1ccc(Cl)c(Cc2ccc(O[C@H]3CCOC3)cc2)c1 |
| InChI | InChI=1S/C19H21ClO2/c1-2-14-5-8-19(20)16(11-14)12-15-3-6-17(7-4-15)22-18-9-10-21-13-18/h3-8,11,18H,2,9-10,12-13H2,1H3/t18-/m0/s1 |
| InChIKey | GVZZLIPFZNLING-SFHVURJKSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |