C23H25ClO7 — CID 163202753
(1R,2S,3S,4R)-5-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 163202753) has the molecular formula C23H25ClO7 and a molecular weight of 448.90 g/mol. Its IUPAC name is (1R,2S,3S,4R)-5-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1R,2S,3S,4R)-5-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 163202753 |
| Molecular Formula | C23H25ClO7 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (1R,2S,3S,4R)-5-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | O[C@H]1[C@H](O)[C@H]2COC(c3ccc(Cl)c(Cc4ccc(O[C@H]5CCOC5)cc4)c3)(O2)[C@@H]1O |
| InChI | InChI=1S/C23H25ClO7/c24-18-6-3-15(23-22(27)21(26)20(25)19(31-23)12-29-23)10-14(18)9-13-1-4-16(5-2-13)30-17-7-8-28-11-17/h1-6,10,17,19-22,25-27H,7-9,11-12H2/t17-,19+,20+,21-,22+,23?/m0/s1 |
| InChIKey | IVFCHENAEMIEDX-RQPXCORLSA-N |
| XLogP | 1.76 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |