C19H19ClO2 — CID 175298744
3-[4-[(2-chloro-5-ethenylphenyl)methyl]phenoxy]oxolane (PubChem CID 175298744) has the molecular formula C19H19ClO2 and a molecular weight of 314.81 g/mol. Its IUPAC name is 3-[4-[(2-chloro-5-ethenylphenyl)methyl]phenoxy]oxolane.
| Compound Name | 3-[4-[(2-chloro-5-ethenylphenyl)methyl]phenoxy]oxolane |
|---|---|
| PubChem CID | 175298744 |
| Molecular Formula | C19H19ClO2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-[4-[(2-chloro-5-ethenylphenyl)methyl]phenoxy]oxolane |
| SMILES | C=Cc1ccc(Cl)c(Cc2ccc(OC3CCOC3)cc2)c1 |
| InChI | InChI=1S/C19H19ClO2/c1-2-14-5-8-19(20)16(11-14)12-15-3-6-17(7-4-15)22-18-9-10-21-13-18/h2-8,11,18H,1,9-10,12-13H2 |
| InChIKey | OABNZHMXVXPSLL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |