C23H33ClO2 — CID 176995671
3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane;ethane (PubChem CID 176995671) has the molecular formula C23H33ClO2 and a molecular weight of 376.97 g/mol. Its IUPAC name is 3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane;ethane.
| Compound Name | 3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane;ethane |
|---|---|
| PubChem CID | 176995671 |
| Molecular Formula | C23H33ClO2 |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 3-[4-[(2-chloro-5-ethylphenyl)methyl]phenoxy]oxolane;ethane |
| SMILES | CC.CC.CCc1ccc(Cl)c(Cc2ccc(OC3CCOC3)cc2)c1 |
| InChI | InChI=1S/C19H21ClO2.2C2H6/c1-2-14-5-8-19(20)16(11-14)12-15-3-6-17(7-4-15)22-18-9-10-21-13-18;2*1-2/h3-8,11,18H,2,9-10,12-13H2,1H3;2*1-2H3 |
| InChIKey | ZQHWTDFXMRACAW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |