C31H39ClO5 — CID 118501616
(2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(prop-2-enoxy)oxane (PubChem CID 118501616) has the molecular formula C31H39ClO5 and a molecular weight of 527.10 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(prop-2-enoxy)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(prop-2-enoxy)oxane |
|---|---|
| PubChem CID | 118501616 |
| Molecular Formula | C31H39ClO5 |
| Molecular Weight | 527.10 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-[(3S)-oxolan-3-yl]oxyphenyl]methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(prop-2-enoxy)oxane |
| SMILES | C=CCO[C@@H]1[C@@H](OCC=C)[C@H](C)[C@@H](CC)O[C@H]1c1ccc(Cl)c(Cc2ccc(O[C@H]3CCOC3)cc2)c1 |
| InChI | InChI=1S/C31H39ClO5/c1-5-15-34-29-21(4)28(7-3)37-30(31(29)35-16-6-2)23-10-13-27(32)24(19-23)18-22-8-11-25(12-9-22)36-26-14-17-33-20-26/h5-6,8-13,19,21,26,28-31H,1-2,7,14-18,20H2,3-4H3/t21-,26+,28-,29+,30+,31-/m1/s1 |
| InChIKey | AUDBAZPVOUKBQX-AKIRZHQMSA-N |
| XLogP | 6.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.10 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|