C44H46ClO10P — CID 155346428
[(2R,3R,4R,5S,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl dihydrogen phosphate (PubChem CID 155346428) has the molecular formula C44H46ClO10P and a molecular weight of 801.27 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155346428 |
| Molecular Formula | C44H46ClO10P |
| Molecular Weight | 801.27 g/mol |
| Exact Mass | 800.25 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-[4-chloro-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OC4CCOC4)cc3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H46ClO10P/c45-39-21-18-35(25-36(39)24-31-16-19-37(20-17-31)54-38-22-23-49-29-38)41-43(51-27-33-12-6-2-7-13-33)44(52-28-34-14-8-3-9-15-34)42(40(55-41)30-53-56(46,47)48)50-26-32-10-4-1-5-11-32/h1-21,25,38,40-44H,22-24,26-30H2,(H2,46,47,48)/t38?,40-,41+,42-,43?,44+/m1/s1 |
| InChIKey | IKEHDLINPBXBDC-VGLGHIAXSA-N |
| XLogP | 8.40 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.27 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|