C48H47ClO6 — CID 59899439
(2S,3S,4R,5R,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 59899439) has the molecular formula C48H47ClO6 and a molecular weight of 755.35 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4R,5R,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 59899439 |
| Molecular Formula | C48H47ClO6 |
| Molecular Weight | 755.35 g/mol |
| Exact Mass | 754.31 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | COc1ccc(Cc2cc([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C48H47ClO6/c1-50-42-25-22-35(23-26-42)28-41-29-40(24-27-43(41)49)45-47(53-32-38-18-10-4-11-19-38)48(54-33-39-20-12-5-13-21-39)46(52-31-37-16-8-3-9-17-37)44(55-45)34-51-30-36-14-6-2-7-15-36/h2-27,29,44-48H,28,30-34H2,1H3/t44-,45+,46-,47?,48+/m1/s1 |
| InChIKey | JYYVJTFDCMLRPA-XWSLCOIISA-N |
| XLogP | 10.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.35 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |