C46H42ClN3O5 — CID 67288632
6-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]pyridazine-3-carbonitrile (PubChem CID 67288632) has the molecular formula C46H42ClN3O5 and a molecular weight of 752.31 g/mol. Its IUPAC name is 6-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]pyridazine-3-carbonitrile.
| Compound Name | 6-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 67288632 |
| Molecular Formula | C46H42ClN3O5 |
| Molecular Weight | 752.31 g/mol |
| Exact Mass | 751.28 |
| IUPAC Name | 6-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(Cc2cc([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2Cl)nn1 |
| InChI | InChI=1S/C46H42ClN3O5/c47-41-24-21-37(25-38(41)26-39-22-23-40(27-48)50-49-39)43-45(53-30-35-17-9-3-10-18-35)46(54-31-36-19-11-4-12-20-36)44(52-29-34-15-7-2-8-16-34)42(55-43)32-51-28-33-13-5-1-6-14-33/h1-25,42-46H,26,28-32H2/t42-,43+,44-,45?,46+/m1/s1 |
| InChIKey | IOJFVLGJATWHLA-YEOVNALFSA-N |
| XLogP | 9.01 |
| TPSA | 95.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.31 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |