C42H44ClN3O5 — CID 140617238
N'-amino-2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]ethanimidamide (PubChem CID 140617238) has the molecular formula C42H44ClN3O5 and a molecular weight of 706.28 g/mol. Its IUPAC name is N'-amino-2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]ethanimidamide.
| Compound Name | N'-amino-2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 140617238 |
| Molecular Formula | C42H44ClN3O5 |
| Molecular Weight | 706.28 g/mol |
| Exact Mass | 705.30 |
| IUPAC Name | N'-amino-2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]ethanimidamide |
| SMILES | N/N=C(/N)Cc1cc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C42H44ClN3O5/c43-36-22-21-34(23-35(36)24-38(44)46-45)39-41(49-27-32-17-9-3-10-18-32)42(50-28-33-19-11-4-12-20-33)40(48-26-31-15-7-2-8-16-31)37(51-39)29-47-25-30-13-5-1-6-14-30/h1-23,37,39-42H,24-29,45H2,(H2,44,46)/t37-,39+,40-,41?,42+/m1/s1 |
| InChIKey | XNTFURVFTUFVNI-IZFWBQOQSA-N |
| XLogP | 7.53 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.28 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|