C50H61ClO6Si — CID 77260001
[2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy-tri(propan-2-yl)silane (PubChem CID 77260001) has the molecular formula C50H61ClO6Si and a molecular weight of 821.57 g/mol. Its IUPAC name is [2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 77260001 |
| Molecular Formula | C50H61ClO6Si |
| Molecular Weight | 821.57 g/mol |
| Exact Mass | 820.39 |
| IUPAC Name | [2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCc1cc(C2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)ccc1Cl)(C(C)C)C(C)C |
| InChI | InChI=1S/C50H61ClO6Si/c1-36(2)58(37(3)4,38(5)6)56-34-44-29-43(27-28-45(44)51)47-49(54-32-41-23-15-9-16-24-41)50(55-33-42-25-17-10-18-26-42)48(53-31-40-21-13-8-14-22-40)46(57-47)35-52-30-39-19-11-7-12-20-39/h7-29,36-38,46-50H,30-35H2,1-6H3 |
| InChIKey | QQBOHRWTBLJRSM-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.57 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|