C48H59ClO6SSi — CID 77179016
[2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]thiophen-3-yl]methoxy-tri(propan-2-yl)silane (PubChem CID 77179016) has the molecular formula C48H59ClO6SSi and a molecular weight of 827.60 g/mol. Its IUPAC name is [2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]thiophen-3-yl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]thiophen-3-yl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 77179016 |
| Molecular Formula | C48H59ClO6SSi |
| Molecular Weight | 827.60 g/mol |
| Exact Mass | 826.35 |
| IUPAC Name | [2-chloro-5-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]thiophen-3-yl]methoxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCc1cc(C2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)sc1Cl)(C(C)C)C(C)C |
| InChI | InChI=1S/C48H59ClO6SSi/c1-34(2)57(35(3)4,36(5)6)54-32-41-27-43(56-48(41)49)45-47(53-31-40-25-17-10-18-26-40)46(52-30-39-23-15-9-16-24-39)44(51-29-38-21-13-8-14-22-38)42(55-45)33-50-28-37-19-11-7-12-20-37/h7-27,34-36,42,44-47H,28-33H2,1-6H3 |
| InChIKey | GJBVFNWJXGBPJN-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.60 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|