C41H39BrClFO5 — CID 53330621
(3S,4R,5R,6R)-2-[5-(bromomethyl)-4-chloro-2-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 53330621) has the molecular formula C41H39BrClFO5 and a molecular weight of 746.11 g/mol. Its IUPAC name is (3S,4R,5R,6R)-2-[5-(bromomethyl)-4-chloro-2-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3S,4R,5R,6R)-2-[5-(bromomethyl)-4-chloro-2-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 53330621 |
| Molecular Formula | C41H39BrClFO5 |
| Molecular Weight | 746.11 g/mol |
| Exact Mass | 744.17 |
| IUPAC Name | (3S,4R,5R,6R)-2-[5-(bromomethyl)-4-chloro-2-fluorophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | Fc1cc(Cl)c(CBr)cc1C1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C41H39BrClFO5/c42-23-33-21-34(36(44)22-35(33)43)38-40(47-26-31-17-9-3-10-18-31)41(48-27-32-19-11-4-12-20-32)39(46-25-30-15-7-2-8-16-30)37(49-38)28-45-24-29-13-5-1-6-14-29/h1-22,37-41H,23-28H2/t37-,38?,39-,40?,41+/m1/s1 |
| InChIKey | WCZMFXBBSWEULG-LXSAJGLOSA-N |
| XLogP | 9.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.11 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|