C35H37BrO5 — CID 10531876
(2S,3R,4R,5S,6R)-3-(bromomethyl)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10531876) has the molecular formula C35H37BrO5 and a molecular weight of 617.58 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-3-(bromomethyl)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3R,4R,5S,6R)-3-(bromomethyl)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10531876 |
| Molecular Formula | C35H37BrO5 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | (2S,3R,4R,5S,6R)-3-(bromomethyl)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | BrC[C@H]1[C@@H](OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H37BrO5/c36-21-31-33(38-23-28-15-7-2-8-16-28)34(39-24-29-17-9-3-10-18-29)32(26-37-22-27-13-5-1-6-14-27)41-35(31)40-25-30-19-11-4-12-20-30/h1-20,31-35H,21-26H2/t31-,32-,33-,34-,35+/m1/s1 |
| InChIKey | YSBPEDLSQSKGRN-JSMUHSIHSA-N |
| XLogP | 7.33 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|