C30H34BrClO5 — CID 10627231
(2S,3S,4R,5S,6R)-3-(bromomethyl)-2-(2-chloroethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10627231) has the molecular formula C30H34BrClO5 and a molecular weight of 589.95 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-3-(bromomethyl)-2-(2-chloroethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4R,5S,6R)-3-(bromomethyl)-2-(2-chloroethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10627231 |
| Molecular Formula | C30H34BrClO5 |
| Molecular Weight | 589.95 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | (2S,3S,4R,5S,6R)-3-(bromomethyl)-2-(2-chloroethoxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | ClCCO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1CBr |
| InChI | InChI=1S/C30H34BrClO5/c31-18-26-28(35-20-24-12-6-2-7-13-24)29(36-21-25-14-8-3-9-15-25)27(37-30(26)34-17-16-32)22-33-19-23-10-4-1-5-11-23/h1-15,26-30H,16-22H2/t26-,27+,28+,29+,30-/m0/s1 |
| InChIKey | KIFSQLYIMUILIS-OEWGIKMGSA-N |
| XLogP | 6.37 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.95 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|