C53H57ClO7 — CID 59557722
1-[[5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]propan-2-ol (PubChem CID 59557722) has the molecular formula C53H57ClO7 and a molecular weight of 841.49 g/mol. Its IUPAC name is 1-[[5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]propan-2-ol.
| Compound Name | 1-[[5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]propan-2-ol |
|---|---|
| PubChem CID | 59557722 |
| Molecular Formula | C53H57ClO7 |
| Molecular Weight | 841.49 g/mol |
| Exact Mass | 840.38 |
| IUPAC Name | 1-[[5-chloro-4-[(4-ethylphenyl)methyl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methoxy]propan-2-ol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)c(COCC(C)O)cc2Cl)cc1 |
| InChI | InChI=1S/C53H57ClO7/c1-3-39-24-26-40(27-25-39)28-45-29-47(46(30-48(45)54)36-56-31-38(2)55)50-52(59-34-43-20-12-6-13-21-43)53(60-35-44-22-14-7-15-23-44)51(58-33-42-18-10-5-11-19-42)49(61-50)37-57-32-41-16-8-4-9-17-41/h4-27,29-30,38,49-53,55H,3,28,31-37H2,1-2H3/t38?,49-,50+,51-,52?,53+/m1/s1 |
| InChIKey | QMQDKQGRYPPEIX-DWLLQGCWSA-N |
| XLogP | 10.80 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.49 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |