C51H51ClO6 — CID 59013481
(3S,3'R,4'S,5'R,6'R)-6-chloro-5-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-1-ol (PubChem CID 59013481) has the molecular formula C51H51ClO6 and a molecular weight of 795.42 g/mol. Its IUPAC name is (3S,3'R,4'S,5'R,6'R)-6-chloro-5-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-1-ol.
| Compound Name | (3S,3'R,4'S,5'R,6'R)-6-chloro-5-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-1-ol |
|---|---|
| PubChem CID | 59013481 |
| Molecular Formula | C51H51ClO6 |
| Molecular Weight | 795.42 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | (3S,3'R,4'S,5'R,6'R)-6-chloro-5-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-1-ol |
| SMILES | CCc1ccc(Cc2cc3c(cc2Cl)C(O)C[C@]32O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C51H51ClO6/c1-2-36-23-25-37(26-24-36)27-42-28-44-43(29-45(42)52)46(53)30-51(44)50(57-34-41-21-13-6-14-22-41)49(56-33-40-19-11-5-12-20-40)48(55-32-39-17-9-4-10-18-39)47(58-51)35-54-31-38-15-7-3-8-16-38/h3-26,28-29,46-50,53H,2,27,30-35H2,1H3/t46?,47-,48-,49+,50-,51+/m1/s1 |
| InChIKey | OYSFNIRHSDPYTO-QYMZDAIXSA-N |
| XLogP | 10.50 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.42 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |