C51H49FO7 — CID 59488796
2-(4-ethylphenyl)-1-[(3S,3'R,4'S,5'R,6'R)-6-fluoro-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-5-yl]ethanone (PubChem CID 59488796) has the molecular formula C51H49FO7 and a molecular weight of 792.94 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-[(3S,3'R,4'S,5'R,6'R)-6-fluoro-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-5-yl]ethanone.
| Compound Name | 2-(4-ethylphenyl)-1-[(3S,3'R,4'S,5'R,6'R)-6-fluoro-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-5-yl]ethanone |
|---|---|
| PubChem CID | 59488796 |
| Molecular Formula | C51H49FO7 |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.35 |
| IUPAC Name | 2-(4-ethylphenyl)-1-[(3S,3'R,4'S,5'R,6'R)-6-fluoro-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-2-benzofuran-3,2'-oxane]-5-yl]ethanone |
| SMILES | CCc1ccc(CC(=O)c2cc3c(cc2F)CO[C@]32O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C51H49FO7/c1-2-36-23-25-37(26-24-36)27-46(53)43-29-44-42(28-45(43)52)34-58-51(44)50(57-33-41-21-13-6-14-22-41)49(56-32-40-19-11-5-12-20-40)48(55-31-39-17-9-4-10-18-39)47(59-51)35-54-30-38-15-7-3-8-16-38/h3-26,28-29,47-50H,2,27,30-35H2,1H3/t47-,48-,49+,50-,51+/m1/s1 |
| InChIKey | QMTOZBCCYVJASN-PKVCVKGNSA-N |
| XLogP | 9.87 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |