C51H52O6 — CID 86621845
(3'R,4S,4'S,5'R,6'R)-6-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydrochromene-4,2'-oxane] (PubChem CID 86621845) has the molecular formula C51H52O6 and a molecular weight of 760.97 g/mol. Its IUPAC name is (3'R,4S,4'S,5'R,6'R)-6-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydrochromene-4,2'-oxane].
| Compound Name | (3'R,4S,4'S,5'R,6'R)-6-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydrochromene-4,2'-oxane] |
|---|---|
| PubChem CID | 86621845 |
| Molecular Formula | C51H52O6 |
| Molecular Weight | 760.97 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | (3'R,4S,4'S,5'R,6'R)-6-[(4-ethylphenyl)methyl]-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[2,3-dihydrochromene-4,2'-oxane] |
| SMILES | CCc1ccc(Cc2ccc3c(c2)[C@]2(CCO3)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C51H52O6/c1-2-38-23-25-39(26-24-38)31-44-27-28-46-45(32-44)51(29-30-53-46)50(56-36-43-21-13-6-14-22-43)49(55-35-42-19-11-5-12-20-42)48(54-34-41-17-9-4-10-18-41)47(57-51)37-52-33-40-15-7-3-8-16-40/h3-28,32,47-50H,2,29-31,33-37H2,1H3/t47-,48-,49+,50-,51+/m1/s1 |
| InChIKey | SRMABSAHDVJCMK-PKVCVKGNSA-N |
| XLogP | 10.19 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.97 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |