C52H56O6 — CID 67460491
(1S,2R,3S,4R,5R)-1-[2-ethoxy-5-[(4-ethylphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexan-1-ol (PubChem CID 67460491) has the molecular formula C52H56O6 and a molecular weight of 777.01 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R)-1-[2-ethoxy-5-[(4-ethylphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexan-1-ol.
| Compound Name | (1S,2R,3S,4R,5R)-1-[2-ethoxy-5-[(4-ethylphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 67460491 |
| Molecular Formula | C52H56O6 |
| Molecular Weight | 777.01 g/mol |
| Exact Mass | 776.41 |
| IUPAC Name | (1S,2R,3S,4R,5R)-1-[2-ethoxy-5-[(4-ethylphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexan-1-ol |
| SMILES | CCOc1ccc(Cc2ccc(CC)cc2)cc1[C@@]1(O)C[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C52H56O6/c1-3-39-25-27-40(28-26-39)31-45-29-30-48(55-4-2)47(32-45)52(53)33-46(38-54-34-41-17-9-5-10-18-41)49(56-35-42-19-11-6-12-20-42)50(57-36-43-21-13-7-14-22-43)51(52)58-37-44-23-15-8-16-24-44/h5-30,32,46,49-51,53H,3-4,31,33-38H2,1-2H3/t46-,49-,50?,51-,52+/m1/s1 |
| InChIKey | NGHURMUQWRETCJ-HFKUJGOHSA-N |
| XLogP | 10.42 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.01 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |