C56H56O6S — CID 59243507
(3R,4S,5S,6R)-2-[4-methyl-5-[(4-methylphenyl)methyl]-2-phenylmethoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol (PubChem CID 59243507) has the molecular formula C56H56O6S and a molecular weight of 857.13 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-methyl-5-[(4-methylphenyl)methyl]-2-phenylmethoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[4-methyl-5-[(4-methylphenyl)methyl]-2-phenylmethoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 59243507 |
| Molecular Formula | C56H56O6S |
| Molecular Weight | 857.13 g/mol |
| Exact Mass | 856.38 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-methyl-5-[(4-methylphenyl)methyl]-2-phenylmethoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
| SMILES | Cc1ccc(Cc2cc(C3(O)S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c(OCc3ccccc3)cc2C)cc1 |
| InChI | InChI=1S/C56H56O6S/c1-41-28-30-43(31-29-41)33-49-34-50(51(32-42(49)2)59-36-45-20-10-4-11-21-45)56(57)55(62-39-48-26-16-7-17-27-48)54(61-38-47-24-14-6-15-25-47)53(60-37-46-22-12-5-13-23-46)52(63-56)40-58-35-44-18-8-3-9-19-44/h3-32,34,52-55,57H,33,35-40H2,1-2H3/t52-,53-,54+,55-,56?/m1/s1 |
| InChIKey | BDNLMKZKQLLVCQ-UNXRTQJZSA-N |
| XLogP | 11.71 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.13 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |