C49H47BrO7S — CID 122439109
(3R,4S,5S,6R)-2-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol (PubChem CID 122439109) has the molecular formula C49H47BrO7S and a molecular weight of 859.88 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 122439109 |
| Molecular Formula | C49H47BrO7S |
| Molecular Weight | 859.88 g/mol |
| Exact Mass | 858.22 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-bromo-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
| SMILES | OC1(c2ccc(Br)c(Cc3ccc4c(c3)OCCO4)c2)S[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H47BrO7S/c50-42-23-22-41(29-40(42)27-39-21-24-43-44(28-39)54-26-25-53-43)49(51)48(57-33-38-19-11-4-12-20-38)47(56-32-37-17-9-3-10-18-37)46(55-31-36-15-7-2-8-16-36)45(58-49)34-52-30-35-13-5-1-6-14-35/h1-24,28-29,45-48,51H,25-27,30-34H2/t45-,46-,47+,48-,49?/m1/s1 |
| InChIKey | CBVVVIXJQXTKLQ-ZQROTMPRSA-N |
| XLogP | 10.04 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.88 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |