C50H51ClO7S — CID 67069093
(3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxy-2-methylphenyl)-hydroxymethyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol (PubChem CID 67069093) has the molecular formula C50H51ClO7S and a molecular weight of 831.47 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxy-2-methylphenyl)-hydroxymethyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxy-2-methylphenyl)-hydroxymethyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 67069093 |
| Molecular Formula | C50H51ClO7S |
| Molecular Weight | 831.47 g/mol |
| Exact Mass | 830.30 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxy-2-methylphenyl)-hydroxymethyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
| SMILES | CCOc1ccc(C(O)c2cc(C3(O)S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)c(C)c1 |
| InChI | InChI=1S/C50H51ClO7S/c1-3-55-41-25-26-42(35(2)28-41)46(52)43-29-40(24-27-44(43)51)50(53)49(58-33-39-22-14-7-15-23-39)48(57-32-38-20-12-6-13-21-38)47(56-31-37-18-10-5-11-19-37)45(59-50)34-54-30-36-16-8-4-9-17-36/h4-29,45-49,52-53H,3,30-34H2,1-2H3/t45-,46?,47-,48+,49-,50?/m1/s1 |
| InChIKey | MLBNZUKKWVYDGC-VCVGUSFVSA-N |
| XLogP | 10.36 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.47 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |