C42H43ClO6 — CID 167017897
(3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 167017897) has the molecular formula C42H43ClO6 and a molecular weight of 679.25 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 167017897 |
| Molecular Formula | C42H43ClO6 |
| Molecular Weight | 679.25 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | (3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | CCOc1ccc(Cc2cc(C3(O)O[C@H](C)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C42H43ClO6/c1-3-45-37-22-19-31(20-23-37)25-35-26-36(21-24-38(35)43)42(44)41(48-29-34-17-11-6-12-18-34)40(47-28-33-15-9-5-10-16-33)39(30(2)49-42)46-27-32-13-7-4-8-14-32/h4-24,26,30,39-41,44H,3,25,27-29H2,1-2H3/t30-,39-,40+,41-,42?/m1/s1 |
| InChIKey | SZNSIAHTHRVELG-CLUOZOPFSA-N |
| XLogP | 8.65 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.25 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |