C30H49ClO5Si3 — CID 58343637
(3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol (PubChem CID 58343637) has the molecular formula C30H49ClO5Si3 and a molecular weight of 609.43 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol |
|---|---|
| PubChem CID | 58343637 |
| Molecular Formula | C30H49ClO5Si3 |
| Molecular Weight | 609.43 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-5-methyl-6-trimethylsilyl-3,4-bis(trimethylsilyloxy)oxan-2-ol |
| SMILES | CCOc1ccc(Cc2cc(C3(O)O[C@H]([Si](C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C30H49ClO5Si3/c1-12-33-25-16-13-22(14-17-25)19-23-20-24(15-18-26(23)31)30(32)28(36-39(9,10)11)27(35-38(6,7)8)21(2)29(34-30)37(3,4)5/h13-18,20-21,27-29,32H,12,19H2,1-11H3/t21-,27-,28+,29+,30?/m0/s1 |
| InChIKey | IOBCGFLARXXVNY-BNFVGJJTSA-N |
| XLogP | 7.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.43 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|