C33H54ClF3O7Si4 — CID 131736385
(2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]phenyl]-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol (PubChem CID 131736385) has the molecular formula C33H54ClF3O7Si4 and a molecular weight of 767.58 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]phenyl]-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]phenyl]-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 131736385 |
| Molecular Formula | C33H54ClF3O7Si4 |
| Molecular Weight | 767.58 g/mol |
| Exact Mass | 766.26 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]phenyl]-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-ol |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@@](O)(c2ccc(Cl)c(Cc3ccc(OCC(F)(F)F)cc3)c2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C33H54ClF3O7Si4/c1-45(2,3)40-21-28-29(42-46(4,5)6)30(43-47(7,8)9)31(44-48(10,11)12)33(38,41-28)25-15-18-27(34)24(20-25)19-23-13-16-26(17-14-23)39-22-32(35,36)37/h13-18,20,28-31,38H,19,21-22H2,1-12H3/t28-,29-,30+,31-,33+/m1/s1 |
| InChIKey | BHLFFENEZNJTHY-PAGFLGSUSA-N |
| XLogP | 8.93 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.58 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|