C58H61ClO7Si — CID 142416430
(3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 142416430) has the molecular formula C58H61ClO7Si and a molecular weight of 933.66 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 142416430 |
| Molecular Formula | C58H61ClO7Si |
| Molecular Weight | 933.66 g/mol |
| Exact Mass | 932.39 |
| IUPAC Name | (3R,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | CCOc1ccc(Cc2cc(C3(O)O[C@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C58H61ClO7Si/c1-5-61-49-34-31-43(32-35-49)37-47-38-48(33-36-52(47)59)58(60)56(64-41-46-25-15-8-16-26-46)55(63-40-45-23-13-7-14-24-45)54(62-39-44-21-11-6-12-22-44)53(66-58)42-65-67(57(2,3)4,50-27-17-9-18-28-50)51-29-19-10-20-30-51/h6-36,38,53-56,60H,5,37,39-42H2,1-4H3/t53-,54-,55+,56-,58?/m1/s1 |
| InChIKey | DTPAWIGAYIAPGS-SXOQVFNXSA-N |
| XLogP | 11.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.66 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|