C43H45ClO7 — CID 52914724
[(3S,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 52914724) has the molecular formula C43H45ClO7 and a molecular weight of 709.28 g/mol. Its IUPAC name is [(3S,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(3S,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 52914724 |
| Molecular Formula | C43H45ClO7 |
| Molecular Weight | 709.28 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | [(3S,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-(hydroxymethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3OC(CO)(CO)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C43H45ClO7/c1-2-47-37-21-18-31(19-22-37)24-36-25-35(20-23-38(36)44)39-40(48-26-32-12-6-3-7-13-32)41(49-27-33-14-8-4-9-15-33)42(43(29-45,30-46)51-39)50-28-34-16-10-5-11-17-34/h3-23,25,39-42,45-46H,2,24,26-30H2,1H3/t39-,40-,41+,42-/m0/s1 |
| InChIKey | YQRVGYKYLKAJCM-GFUJKPJOSA-N |
| XLogP | 7.88 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.28 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |