C48H53ClO8 — CID 142746897
[(2R,3R,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 142746897) has the molecular formula C48H53ClO8 and a molecular weight of 793.40 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 142746897 |
| Molecular Formula | C48H53ClO8 |
| Molecular Weight | 793.40 g/mol |
| Exact Mass | 792.34 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl 2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](COC(=O)COC(C)(C)C)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C48H53ClO8/c1-5-51-40-24-21-34(22-25-40)27-39-28-38(23-26-41(39)49)44-46(54-30-36-17-11-7-12-18-36)47(55-31-37-19-13-8-14-20-37)45(53-29-35-15-9-6-10-16-35)42(57-44)32-52-43(50)33-56-48(2,3)4/h6-26,28,42,44-47H,5,27,29-33H2,1-4H3/t42-,44+,45-,46?,47+/m1/s1 |
| InChIKey | FVCUCRAFAPUWKJ-FQHHUDHMSA-N |
| XLogP | 9.88 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.40 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |