C27H33ClO6 — CID 58340775
[(2S,3S,4S,5R,6S)-5-acetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 58340775) has the molecular formula C27H33ClO6 and a molecular weight of 489.01 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-5-acetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-5-acetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58340775 |
| Molecular Formula | C27H33ClO6 |
| Molecular Weight | 489.01 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-5-acetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](COC(C)=O)[C@@H](C)[C@H](C)[C@H]3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C27H33ClO6/c1-6-31-23-10-7-20(8-11-23)13-22-14-21(9-12-24(22)28)27-26(33-19(5)30)17(3)16(2)25(34-27)15-32-18(4)29/h7-12,14,16-17,25-27H,6,13,15H2,1-5H3/t16-,17-,25+,26+,27-/m0/s1 |
| InChIKey | AJDLFBRWSZYNMH-XDBSYFINSA-N |
| XLogP | 5.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.01 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |