C26H33ClO4 — CID 58340789
[(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 58340789) has the molecular formula C26H33ClO4 and a molecular weight of 445.00 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58340789 |
| Molecular Formula | C26H33ClO4 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CC)[C@@H](C)[C@H](C)[C@H]3OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H33ClO4/c1-6-24-16(3)17(4)25(30-18(5)28)26(31-24)20-10-13-23(27)21(15-20)14-19-8-11-22(12-9-19)29-7-2/h8-13,15-17,24-26H,6-7,14H2,1-5H3/t16-,17-,24+,25+,26-/m0/s1 |
| InChIKey | CCBHPMYBNWIYPZ-COAQTKGJSA-N |
| XLogP | 6.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |