C24H31ClO2 — CID 160813919
(2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-3,4,5-trimethyloxane (PubChem CID 160813919) has the molecular formula C24H31ClO2 and a molecular weight of 386.96 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-3,4,5-trimethyloxane.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 160813919 |
| Molecular Formula | C24H31ClO2 |
| Molecular Weight | 386.96 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-3,4,5-trimethyloxane |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OC)cc3)c2)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H31ClO2/c1-6-23-16(3)15(2)17(4)24(27-23)19-9-12-22(25)20(14-19)13-18-7-10-21(26-5)11-8-18/h7-12,14-17,23-24H,6,13H2,1-5H3/t15-,16-,17+,23+,24+/m0/s1 |
| InChIKey | NEUVBNTXNSPHLI-YSWUJHBYSA-N |
| XLogP | 6.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.96 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |