C36H39ClO3S — CID 58238984
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane (PubChem CID 58238984) has the molecular formula C36H39ClO3S and a molecular weight of 587.23 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane |
|---|---|
| PubChem CID | 58238984 |
| Molecular Formula | C36H39ClO3S |
| Molecular Weight | 587.23 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane |
| SMILES | CC[C@H]1S[C@@H](c2ccc(Cl)c(Cc3ccc(OC)cc3)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C36H39ClO3S/c1-4-33-25(2)34(39-23-27-11-7-5-8-12-27)35(40-24-28-13-9-6-10-14-28)36(41-33)29-17-20-32(37)30(22-29)21-26-15-18-31(38-3)19-16-26/h5-20,22,25,33-36H,4,21,23-24H2,1-3H3/t25-,33-,34+,35?,36+/m1/s1 |
| InChIKey | LGYNXKLGCZBRCX-PCVSRULZSA-N |
| XLogP | 9.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.23 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |