C29H34O3S — CID 58239044
[3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methanol (PubChem CID 58239044) has the molecular formula C29H34O3S and a molecular weight of 462.66 g/mol. Its IUPAC name is [3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methanol.
| Compound Name | [3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 58239044 |
| Molecular Formula | C29H34O3S |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [3-[(2S,3R,4S,5S,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thian-2-yl]phenyl]methanol |
| SMILES | CC[C@H]1S[C@@H](c2cccc(CO)c2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C29H34O3S/c1-3-26-21(2)27(31-19-22-11-6-4-7-12-22)28(32-20-23-13-8-5-9-14-23)29(33-26)25-16-10-15-24(17-25)18-30/h4-17,21,26-30H,3,18-20H2,1-2H3/t21-,26-,27+,28?,29+/m1/s1 |
| InChIKey | QAIZGMCCTMILDD-CXSKWQMBSA-N |
| XLogP | 6.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |