C37H42O3S — CID 58239043
(2S,3R,4S,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane (PubChem CID 58239043) has the molecular formula C37H42O3S and a molecular weight of 566.81 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane |
|---|---|
| PubChem CID | 58239043 |
| Molecular Formula | C37H42O3S |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)thiane |
| SMILES | CCOc1ccc(Cc2cccc([C@@H]3S[C@H](CC)[C@@H](C)[C@H](OCc4ccccc4)C3OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C37H42O3S/c1-4-34-27(3)35(39-25-29-13-8-6-9-14-29)36(40-26-30-15-10-7-11-16-30)37(41-34)32-18-12-17-31(24-32)23-28-19-21-33(22-20-28)38-5-2/h6-22,24,27,34-37H,4-5,23,25-26H2,1-3H3/t27-,34-,35+,36?,37+/m1/s1 |
| InChIKey | SRMXWNWRZOGOIP-XQDGUIGLSA-N |
| XLogP | 9.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |