C22H29NO5 — CID 59431058
(2S,3S,4R,5R,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol (PubChem CID 59431058) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 59431058 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cccc([C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)N3C)c2)cc1 |
| InChI | InChI=1S/C22H29NO5/c1-3-28-17-9-7-14(8-10-17)11-15-5-4-6-16(12-15)19-21(26)22(27)20(25)18(13-24)23(19)2/h4-10,12,18-22,24-27H,3,11,13H2,1-2H3/t18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | AGHNXKZBDRQJSE-TWGBQZSLSA-N |
| XLogP | 1.11 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |