C22H28N2O7 — CID 173468215
1-methyl-3-[[4-[[3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]urea (PubChem CID 173468215) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is 1-methyl-3-[[4-[[3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]urea.
| Compound Name | 1-methyl-3-[[4-[[3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]urea |
|---|---|
| PubChem CID | 173468215 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-methyl-3-[[4-[[3-[(2S,3R,4R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]urea |
| SMILES | CNC(=O)NCOc1ccc(Cc2cccc([C@@H]3O[C@H](CO)C(O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C22H28N2O7/c1-23-22(29)24-12-30-16-7-5-13(6-8-16)9-14-3-2-4-15(10-14)21-20(28)19(27)18(26)17(11-25)31-21/h2-8,10,17-21,25-28H,9,11-12H2,1H3,(H2,23,24,29)/t17-,18?,19+,20-,21+/m1/s1 |
| InChIKey | BPMSDKMWJFNUMS-XNPMUHQXSA-N |
| XLogP | 0.06 |
| TPSA | 140.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|