C25H30ClNO7 — CID 131968301
1-[3-[[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]azetidin-1-yl]ethanone (PubChem CID 131968301) has the molecular formula C25H30ClNO7 and a molecular weight of 491.97 g/mol. Its IUPAC name is 1-[3-[[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 131968301 |
| Molecular Formula | C25H30ClNO7 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 1-[3-[[4-[[2-chloro-5-[(2S,3R,4R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]methyl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(COc2ccc(Cc3cc([C@@H]4OC(CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3Cl)cc2)C1 |
| InChI | InChI=1S/C25H30ClNO7/c1-14(29)27-10-16(11-27)13-33-19-5-2-15(3-6-19)8-18-9-17(4-7-20(18)26)25-24(32)23(31)22(30)21(12-28)34-25/h2-7,9,16,21-25,28,30-32H,8,10-13H2,1H3/t21?,22-,23+,24-,25+/m1/s1 |
| InChIKey | XRSHIDNAPGODDP-HRSYOHRGSA-N |
| XLogP | 1.30 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |