C23H27ClO8 — CID 143419850
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxyoxolan-3-yl)oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 143419850) has the molecular formula C23H27ClO8 and a molecular weight of 466.91 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxyoxolan-3-yl)oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxyoxolan-3-yl)oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143419850 |
| Molecular Formula | C23H27ClO8 |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(4-hydroxyoxolan-3-yl)oxyphenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OC4COCC4O)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H27ClO8/c24-16-6-3-13(23-22(29)21(28)20(27)18(9-25)32-23)8-14(16)7-12-1-4-15(5-2-12)31-19-11-30-10-17(19)26/h1-6,8,17-23,25-29H,7,9-11H2/t17?,18-,19?,20-,21+,22-,23+/m1/s1 |
| InChIKey | BKHVFAXPMUWYOM-YZIOCVKXSA-N |
| XLogP | 0.58 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |