C29H39ClO8 — CID 157117992
(3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;3-methoxyoxolane (PubChem CID 157117992) has the molecular formula C29H39ClO8 and a molecular weight of 551.08 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;3-methoxyoxolane.
| Compound Name | (3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;3-methoxyoxolane |
|---|---|
| PubChem CID | 157117992 |
| Molecular Formula | C29H39ClO8 |
| Molecular Weight | 551.08 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (3R,4R,5S,6R)-2-[4-chloro-3-[(4-cyclopentyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;3-methoxyoxolane |
| SMILES | COC1CCOC1.OC[C@H]1OC(c2ccc(Cl)c(Cc3ccc(OC4CCCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29ClO6.C5H10O2/c25-19-10-7-15(24-23(29)22(28)21(27)20(13-26)31-24)12-16(19)11-14-5-8-18(9-6-14)30-17-3-1-2-4-17;1-6-5-2-3-7-4-5/h5-10,12,17,20-24,26-29H,1-4,11,13H2;5H,2-4H2,1H3/t20-,21-,22+,23-,24?;/m1./s1 |
| InChIKey | AHPZYYHVZCDDPC-ZAWBPVKTSA-N |
| XLogP | 3.19 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.08 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |