C24H30O7 — CID 71085530
(2R,3S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]oxane-3,4,5-triol (PubChem CID 71085530) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71085530 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2R,3S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[[4-(oxolan-3-yloxy)phenyl]methyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)C(O)[C@H]2O)cc1Cc1ccc(OC2CCOC2)cc1 |
| InChI | InChI=1S/C24H30O7/c1-14-2-5-16(24-23(28)22(27)21(26)20(12-25)31-24)11-17(14)10-15-3-6-18(7-4-15)30-19-8-9-29-13-19/h2-7,11,19-28H,8-10,12-13H2,1H3/t19?,20-,21-,22?,23-,24+/m1/s1 |
| InChIKey | GLGHFXKHVNORIQ-QTIJMRAVSA-N |
| XLogP | 1.27 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |