C26H36O7 — CID 143419862
(2S,3R,4R,5S,6R)-2-[3-[(4-cyclohexyloxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrate (PubChem CID 143419862) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-cyclohexyloxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrate.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-cyclohexyloxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrate |
|---|---|
| PubChem CID | 143419862 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-cyclohexyloxyphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;hydrate |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(OC2CCCCC2)cc1.O |
| InChI | InChI=1S/C26H34O6.H2O/c1-16-7-10-18(26-25(30)24(29)23(28)22(15-27)32-26)14-19(16)13-17-8-11-21(12-9-17)31-20-5-3-2-4-6-20;/h7-12,14,20,22-30H,2-6,13,15H2,1H3;1H2/t22-,23-,24+,25-,26+;/m1./s1 |
| InChIKey | VHOVZQCZTOAADQ-HYECGDDNSA-N |
| XLogP | 1.99 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |