C27H35ClO7 — CID 56683501
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-cyclohexyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56683501) has the molecular formula C27H35ClO7 and a molecular weight of 507.02 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-cyclohexyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-cyclohexyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56683501 |
| Molecular Formula | C27H35ClO7 |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-cyclohexyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(OCCOC4CCCCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H35ClO7/c28-22-11-8-18(27-26(32)25(31)24(30)23(16-29)35-27)15-19(22)14-17-6-9-21(10-7-17)34-13-12-33-20-4-2-1-3-5-20/h6-11,15,20,23-27,29-32H,1-5,12-14,16H2/t23-,24-,25+,26-,27+/m1/s1 |
| InChIKey | PFPDGTCGMHMTSH-SEFGFODJSA-N |
| XLogP | 3.17 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|