C28H38ClNO8S — CID 53252773
N-[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]propyl]cyclohexanesulfonamide (PubChem CID 53252773) has the molecular formula C28H38ClNO8S and a molecular weight of 584.13 g/mol. Its IUPAC name is N-[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]propyl]cyclohexanesulfonamide.
| Compound Name | N-[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]propyl]cyclohexanesulfonamide |
|---|---|
| PubChem CID | 53252773 |
| Molecular Formula | C28H38ClNO8S |
| Molecular Weight | 584.13 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | N-[3-[4-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenoxy]propyl]cyclohexanesulfonamide |
| SMILES | O=S(=O)(NCCCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C28H38ClNO8S/c29-23-12-9-19(28-27(34)26(33)25(32)24(17-31)38-28)16-20(23)15-18-7-10-21(11-8-18)37-14-4-13-30-39(35,36)22-5-2-1-3-6-22/h7-12,16,22,24-28,30-34H,1-6,13-15,17H2/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | CWKXTDMHADZDPG-DFLSAPQXSA-N |
| XLogP | 2.47 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|