C24H33ClN2O8S — CID 75992765
2-[4-chloro-3-[[4-[5-(sulfamoylamino)pentoxy]phenyl]methyl]phenyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane (PubChem CID 75992765) has the molecular formula C24H33ClN2O8S and a molecular weight of 545.05 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-[5-(sulfamoylamino)pentoxy]phenyl]methyl]phenyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane.
| Compound Name | 2-[4-chloro-3-[[4-[5-(sulfamoylamino)pentoxy]phenyl]methyl]phenyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane |
|---|---|
| PubChem CID | 75992765 |
| Molecular Formula | C24H33ClN2O8S |
| Molecular Weight | 545.05 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 2-[4-chloro-3-[[4-[5-(sulfamoylamino)pentoxy]phenyl]methyl]phenyl]-3,4,5-trihydroxy-6-(hydroxymethyl)oxane |
| SMILES | NS(=O)(=O)NCCCCCOc1ccc(Cc2cc(C3OC(CO)C(O)C(O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C24H33ClN2O8S/c25-19-9-6-16(24-23(31)22(30)21(29)20(14-28)35-24)13-17(19)12-15-4-7-18(8-5-15)34-11-3-1-2-10-27-36(26,32)33/h4-9,13,20-24,27-31H,1-3,10-12,14H2,(H2,26,32,33) |
| InChIKey | KBRDQPMOOVXTMZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.05 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|