C22H26ClNO6 — CID 123941936
2-[4-chloro-3-[[4-(3-iminopropoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 123941936) has the molecular formula C22H26ClNO6 and a molecular weight of 435.90 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-(3-iminopropoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-chloro-3-[[4-(3-iminopropoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123941936 |
| Molecular Formula | C22H26ClNO6 |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[4-chloro-3-[[4-(3-iminopropoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [H]/N=C/CCOc1ccc(Cc2cc(C3OC(CO)C(O)C(O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H26ClNO6/c23-17-7-4-14(22-21(28)20(27)19(26)18(12-25)30-22)11-15(17)10-13-2-5-16(6-3-13)29-9-1-8-24/h2-8,11,18-22,24-28H,1,9-10,12H2/b24-8+ |
| InChIKey | VWXREASZHBLUBF-KTZMUZOWSA-N |
| XLogP | 1.86 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|