C23H29ClO7 — CID 46927485
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxybutoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46927485) has the molecular formula C23H29ClO7 and a molecular weight of 452.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxybutoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxybutoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46927485 |
| Molecular Formula | C23H29ClO7 |
| Molecular Weight | 452.93 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxybutoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC[C@@H](O)COc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H29ClO7/c1-2-16(26)12-30-17-6-3-13(4-7-17)9-15-10-14(5-8-18(15)24)23-22(29)21(28)20(27)19(11-25)31-23/h3-8,10,16,19-23,25-29H,2,9,11-12H2,1H3/t16-,19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | SXTZSPOUPSYALO-WBWVDNPISA-N |
| XLogP | 1.60 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.93 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |