C25H33ClO8 — CID 46927188
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxy-3-propan-2-yloxypropoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46927188) has the molecular formula C25H33ClO8 and a molecular weight of 496.98 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxy-3-propan-2-yloxypropoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxy-3-propan-2-yloxypropoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46927188 |
| Molecular Formula | C25H33ClO8 |
| Molecular Weight | 496.98 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-[(2R)-2-hydroxy-3-propan-2-yloxypropoxy]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)OC[C@@H](O)COc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H33ClO8/c1-14(2)32-12-18(28)13-33-19-6-3-15(4-7-19)9-17-10-16(5-8-20(17)26)25-24(31)23(30)22(29)21(11-27)34-25/h3-8,10,14,18,21-25,27-31H,9,11-13H2,1-2H3/t18-,21-,22-,23+,24?,25+/m1/s1 |
| InChIKey | UCGOLCFHXQYWQX-DMLFOEEOSA-N |
| XLogP | 1.61 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.98 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |