C26H37ClO7 — CID 158595051
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;pentan-3-ol (PubChem CID 158595051) has the molecular formula C26H37ClO7 and a molecular weight of 497.03 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;pentan-3-ol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;pentan-3-ol |
|---|---|
| PubChem CID | 158595051 |
| Molecular Formula | C26H37ClO7 |
| Molecular Weight | 497.03 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol;pentan-3-ol |
| SMILES | CCC(O)CC.CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClO6.C5H12O/c1-2-27-15-6-3-12(4-7-15)9-14-10-13(5-8-16(14)22)21-20(26)19(25)18(24)17(11-23)28-21;1-3-5(6)4-2/h3-8,10,17-21,23-26H,2,9,11H2,1H3;5-6H,3-4H2,1-2H3/t17-,18-,19+,20-,21+;/m1./s1 |
| InChIKey | HUXSMWRORSBICL-QOXLXMTKSA-N |
| XLogP | 3.01 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.03 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |