C20H23ClO5S — CID 89211455
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-sulfanyloxane-3,4,5-triol (PubChem CID 89211455) has the molecular formula C20H23ClO5S and a molecular weight of 410.92 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-sulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 89211455 |
| Molecular Formula | C20H23ClO5S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-sulfanyloxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](S)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H23ClO5S/c1-2-25-14-6-3-11(4-7-14)9-13-10-12(5-8-15(13)21)19-17(23)16(22)18(24)20(27)26-19/h3-8,10,16-20,22-24,27H,2,9H2,1H3/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | PTWKJGUUNPHAER-SWBPCFCJSA-N |
| XLogP | 2.74 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|