C21H26ClNO7S — CID 170331805
(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxy-N-methyloxane-2-sulfonamide (PubChem CID 170331805) has the molecular formula C21H26ClNO7S and a molecular weight of 471.96 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxy-N-methyloxane-2-sulfonamide.
| Compound Name | (2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxy-N-methyloxane-2-sulfonamide |
|---|---|
| PubChem CID | 170331805 |
| Molecular Formula | C21H26ClNO7S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | (2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxy-N-methyloxane-2-sulfonamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](S(=O)(=O)NC)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H26ClNO7S/c1-3-29-15-7-4-12(5-8-15)10-14-11-13(6-9-16(14)22)20-18(25)17(24)19(26)21(30-20)31(27,28)23-2/h4-9,11,17-21,23-26H,3,10H2,1-2H3/t17-,18-,19+,20+,21-/m1/s1 |
| InChIKey | DGLMAPLNFVRQMM-CRSSMBPESA-N |
| XLogP | 1.36 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |